Input interpretation
bromoacetic acid-d 3
Chemical names and formulas
formula | BrCD_2CO_2D Hill formula | C_2D_3BrO_2 name | bromoacetic acid-d 3 IUPAC name | 2-bromo-2, 2-dideuterioacetic acid deuterio ester alternate names | 2-bromo-2, 2-dideuterio-acetic acid deuterio ester | deuterio 2-bromo-2, 2-dideuterio-acetate | deuterio 2-bromo-2, 2-dideuterioacetate | deuterio 2-bromo-2, 2-dideuterio-ethanoate mass fractions | Br (bromine) 0.563% | O (oxygen) 0.225% | C (carbon) 0.169% | H (hydrogen) 0.0426%
Lewis structure
Draw the Lewis structure of bromoacetic acid-d 3. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the bromine (n_Br, val = 7), carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: n_Br, val + 2 n_C, val + 3 n_H, val + 2 n_O, val = 30 Calculate the number of electrons needed to completely fill the valence shells for bromine (n_Br, full = 8), carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): n_Br, full + 2 n_C, full + 3 n_H, full + 2 n_O, full = 46 Subtracting these two numbers shows that 46 - 30 = 16 bonding electrons are needed. Each bond has two electrons, so in addition to the 7 bonds already present in the diagram add 1 bond. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 1 bond by pairing electrons between adjacent highlighted atoms: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 141.97 g/mol phase | solid (at STP) melting point | 48 °C boiling point | 208 °C
Units
Non-standard atom properties
H-2 | 3
Chemical identifiers
CAS number | 14341-48-1 PubChem CID number | 12229903 PubChem SID number | 24872380 SMILES identifier | C(C(=O)O)Br InChI identifier | InChI=1/C2H3BrO2/c3-1-2(4)5/h1H2, (H, 4, 5)/i1D2/hD/f/h4H/i1D2, 4D MDL number | MFCD00190384
Safety properties
flash point | 110 °C