Input interpretation
![random | chemical](../image_source/fa6e7730d8d967a4355161adb06ca453.png)
random | chemical
Result
![3-methyl-1-phenylindoline-2-one](../image_source/c22ffde9237dc7cd27f2ab3e99e39498.png)
3-methyl-1-phenylindoline-2-one
Chemical names and formulas
![formula | C_15H_13NO name | 3-methyl-1-phenylindoline-2-one IUPAC name | 3-methyl-1-phenyl-2-indolinone alternate names | 3-methyl-1-phenyl-3H-indol-2-one | 3-methyl-1-phenyl-indolin-2-one | 3-methyl-1-phenyl-oxindole mass fractions | C (carbon) 80.7% | H (hydrogen) 5.87% | N (nitrogen) 6.27% | O (oxygen) 7.17%](../image_source/c2ecb2a4c137e469cbc6bd647b41e9b2.png)
formula | C_15H_13NO name | 3-methyl-1-phenylindoline-2-one IUPAC name | 3-methyl-1-phenyl-2-indolinone alternate names | 3-methyl-1-phenyl-3H-indol-2-one | 3-methyl-1-phenyl-indolin-2-one | 3-methyl-1-phenyl-oxindole mass fractions | C (carbon) 80.7% | H (hydrogen) 5.87% | N (nitrogen) 6.27% | O (oxygen) 7.17%
Lewis structure
![Draw the Lewis structure of 3-methyl-1-phenylindoline-2-one. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: 15 n_C, val + 13 n_H, val + n_N, val + n_O, val = 84 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): 15 n_C, full + 13 n_H, full + n_N, full + n_O, full = 162 Subtracting these two numbers shows that 162 - 84 = 78 bonding electrons are needed. Each bond has two electrons, so in addition to the 32 bonds already present in the diagram add 7 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 7 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom rings are aromatic, so that the single and double bonds may be rearranged: Answer: | |](../image_source/341cce535297b60a2bae365b9d87d956.png)
Draw the Lewis structure of 3-methyl-1-phenylindoline-2-one. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: 15 n_C, val + 13 n_H, val + n_N, val + n_O, val = 84 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): 15 n_C, full + 13 n_H, full + n_N, full + n_O, full = 162 Subtracting these two numbers shows that 162 - 84 = 78 bonding electrons are needed. Each bond has two electrons, so in addition to the 32 bonds already present in the diagram add 7 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 7 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom rings are aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
![3D structure](../image_source/60fef71917bb9ff88f18e93bfbb870be.png)
3D structure
Basic properties
![molar mass | 223.27 g/mol phase | solid (at STP) melting point | 79.5 °C](../image_source/bcb76175c1db9cef2f9e472766e9784e.png)
molar mass | 223.27 g/mol phase | solid (at STP) melting point | 79.5 °C
Units
Chemical identifiers
![CAS number | 23210-22-2 PubChem CID number | 4990835 PubChem SID number | 24879569 SMILES identifier | CC1C2=CC=CC=C2N(C1=O)C3=CC=CC=C3 InChI identifier | InChI=1/C15H13NO/c1-11-13-9-5-6-10-14(13)16(15(11)17)12-7-3-2-4-8-12/h2-11H, 1H3 MDL number | MFCD00798609](../image_source/5d183646581e2b4dbbc224d61d95028c.png)
CAS number | 23210-22-2 PubChem CID number | 4990835 PubChem SID number | 24879569 SMILES identifier | CC1C2=CC=CC=C2N(C1=O)C3=CC=CC=C3 InChI identifier | InChI=1/C15H13NO/c1-11-13-9-5-6-10-14(13)16(15(11)17)12-7-3-2-4-8-12/h2-11H, 1H3 MDL number | MFCD00798609