Search

name of magnesium diphenyl

Input interpretation

magnesium diphenyl
magnesium diphenyl

Chemical names and formulas

formula | C_12H_10Mg name | magnesium diphenyl IUPAC name | magnesium cyclohexatriene alternate names | diphenylmagnesium mass fractions | C (carbon) 80.7% | H (hydrogen) 5.65% | Mg (magnesium) 13.6%
formula | C_12H_10Mg name | magnesium diphenyl IUPAC name | magnesium cyclohexatriene alternate names | diphenylmagnesium mass fractions | C (carbon) 80.7% | H (hydrogen) 5.65% | Mg (magnesium) 13.6%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 178.52 g/mol phase | solid (at STP) melting point | 25.9 °C boiling point | 264.5 °C density | 1.161 g/cm^3
molar mass | 178.52 g/mol phase | solid (at STP) melting point | 25.9 °C boiling point | 264.5 °C density | 1.161 g/cm^3

Units

Solid properties (at STP)

density | 1.161 g/cm^3
density | 1.161 g/cm^3

Units

Chemical identifiers

CAS number | 555-54-4 Beilstein number | 3904323 PubChem CID number | 11150 SMILES identifier | C1=CC=[C-]C=C1.C1=CC=[C-]C=C1.[Mg+2] InChI identifier | InChI=1/2C6H5.Mg/c2*1-2-4-6-5-3-1;/h2*1-5H;/q2*-1;+2
CAS number | 555-54-4 Beilstein number | 3904323 PubChem CID number | 11150 SMILES identifier | C1=CC=[C-]C=C1.C1=CC=[C-]C=C1.[Mg+2] InChI identifier | InChI=1/2C6H5.Mg/c2*1-2-4-6-5-3-1;/h2*1-5H;/q2*-1;+2