Search

name of copper(II) nitrate

Input interpretation

copper(II) nitrate
copper(II) nitrate

Chemical names and formulas

formula | Cu(NO_3)_2 Hill formula | CuN_2O_6 name | copper(II) nitrate alternate names | copper dinitrate | cupric nitrate mass fractions | Cu (copper) 33.9% | N (nitrogen) 14.9% | O (oxygen) 51.2%
formula | Cu(NO_3)_2 Hill formula | CuN_2O_6 name | copper(II) nitrate alternate names | copper dinitrate | cupric nitrate mass fractions | Cu (copper) 33.9% | N (nitrogen) 14.9% | O (oxygen) 51.2%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 187.55 g/mol
molar mass | 187.55 g/mol

Units

Chemical identifiers

CAS number | 3251-23-8 PubChem CID number | 18616 SMILES identifier | [Cu+2].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-] MDL number | MFCD00010967
CAS number | 3251-23-8 PubChem CID number | 18616 SMILES identifier | [Cu+2].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-] MDL number | MFCD00010967

Ion equivalents

Cu^(2+) (copper(II) cation) | 1 (NO_3)^- (nitrate anion) | 2
Cu^(2+) (copper(II) cation) | 1 (NO_3)^- (nitrate anion) | 2

Random Queries

IUPAC name of strontium oxide
discovery year of gadolinium vs samarium
formula of sodium nitrate vs sulfuric acid
alternate names of tungstic acid
alternate names of hypoiodite anion vs thiosulfate anion
empirical formula of iron(III) chloride hexahydrate vs chromium(II) formate monohydrate
density of deuterium chloride vs tin bis(tetrafluoroborate)
molar mass of lead(IV) cation vs cobalt(III) cation
crystal class of phyllotungstite
NFPA health rating of fluoboric acid vs 2,2,3,3,3-pentafluoro-1-propanol