Search

SMILES identifier zinc niobate

Input interpretation

zinc niobate | SMILES identifier
zinc niobate | SMILES identifier

Result

[O-][Nb](=O)=O.[O-][Nb](=O)=O.[Zn+2]
[O-][Nb](=O)=O.[O-][Nb](=O)=O.[Zn+2]

Random Queries

alternate names of tellurium(V) cation
hypoiodous acid vs phosphoric acid
ions of potassium trifluoroacetate
IUPAC name of ethylenediaminetetraacetic acid calcium disodium salt
O2 + K2CO3 + FeCr2O4 = CO2 + Fe2O3 + K2CrO4
molar mass of cesium vs nickel dibutyldithiocarbamate
molar mass of tetrahydrogenorthotellurate anion vs sulfate anion
ion class of borate anion vs electron anion
density of iodine bromide vs beryllium
name of thullium(III) cation vs europium(III) cation