Search

SMILES identifier zinc niobate

Input interpretation

zinc niobate | SMILES identifier
zinc niobate | SMILES identifier

Result

[O-][Nb](=O)=O.[O-][Nb](=O)=O.[Zn+2]
[O-][Nb](=O)=O.[O-][Nb](=O)=O.[Zn+2]

Random Queries

nuclear spin of astatine
common compound names of nickel vs manganese
molar mass of iron(II) chloride vs phosphorus(III) iodide
alternate names of nitrogen trioxide
tungsten(VI) ions
element mass fraction of greenhouse gases
ion class of thiocyanate anion vs lead(IV) cation
electronegativity of palladium vs nickel
molar heat of fusion of group 10 elements
chemical types of tetraphenylphosphonium chloride vs gallium(III) iodide