Input interpretation
sodium oxalate
Chemical names and formulas
formula | Na_2C_2O_4 name | sodium oxalate IUPAC name | disodium oxalate alternate names | disodium ethanedioate | disodium oxalate | ethanedioic acid, disodium salt | ethanedioic acid sodium salt | oxalates | oxalic acid disodium salt mass fractions | C (carbon) 17.9% | Na (sodium) 34.3% | O (oxygen) 47.8%
Structure diagram
Structure diagram
vertex count | 8 edge count | 5 Schultz index | 108 Wiener index | 29 Hosoya index | 10 Balaban index | 2.993
Basic properties
molar mass | 134 g/mol phase | solid (at STP) melting point | 260 °C density | 2.27 g/cm^3
Units
Solid properties (at STP)
density | 2.27 g/cm^3
Units
Thermodynamic properties
specific heat of formation Δ_fH° | gas | -9.836 kJ/g molar heat of formation Δ_fH° | gas | -1318 kJ/mol (at STP)
Chemical identifiers
![CAS number | 62-76-0 Beilstein number | 3631622 PubChem CID number | 6125 PubChem SID number | 24863683 SMILES identifier | C(=O)(C(=O)[O-])[O-].[Na+].[Na+] InChI identifier | InChI=1/C2H2O4.2Na/c3-1(4)2(5)6;;/h(H, 3, 4)(H, 5, 6);;/q;2*+1/p-2/fC2O4.2Na/q-2;2m RTECS number | KI1750000 MDL number | MFCD00012465](../image_source/4fef7bdc38f15f945d1724af29f933bf.png)
CAS number | 62-76-0 Beilstein number | 3631622 PubChem CID number | 6125 PubChem SID number | 24863683 SMILES identifier | C(=O)(C(=O)[O-])[O-].[Na+].[Na+] InChI identifier | InChI=1/C2H2O4.2Na/c3-1(4)2(5)6;;/h(H, 3, 4)(H, 5, 6);;/q;2*+1/p-2/fC2O4.2Na/q-2;2m RTECS number | KI1750000 MDL number | MFCD00012465
NFPA label
NFPA label
NFPA health rating | 3 NFPA fire rating | 0 NFPA reactivity rating | 0
Toxicity properties
RTECS classes | human data
Ion equivalents
Na^+ (sodium cation) | 2 (C_2O_4)^(2-) (oxalate anion) | 1