Search

MDL number of [5,6]-fullerene-C70 vs beryllium

Input interpretation

[5, 6]-fullerene-C70 beryllium | MDL number
[5, 6]-fullerene-C70 beryllium | MDL number

Results

[5, 6]-fullerene-C70 | MFCD00146976 beryllium | MFCD00134032
[5, 6]-fullerene-C70 | MFCD00146976 beryllium | MFCD00134032

Random Queries

H2 + Li = LiH
atomic mass of Be-16 vs Pm-147
H2 + TiO2 = H2O + Ti
Cr2(SO4)3 + Ba(NO3)2 = BaSO4 + Cr(NO3)3
nuclear spin of carbon
molar mass of lead(II) methanesulfonate
formula of hafnium vs rubidium dihydrogenarsenate
InChI=1/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3
name of 1-(2,5-difluorobenzyl)piperazine
isotopes of seaborgium