Search

SMILES identifier of 1-methylguanosine

Input interpretation

1-methylguanosine | SMILES identifier
1-methylguanosine | SMILES identifier

Result

CN1C(=O)C2=C(N=C1N)N(C=N2)C3C(C(C(O3)CO)O)O
CN1C(=O)C2=C(N=C1N)N(C=N2)C3C(C(C(O3)CO)O)O

Random Queries

NaOH + I2 + CH3CHO = H2O + NaI + CHI3 + HCOONa
alternate names of manganese(VI) cation vs chromium(III) cation
name of hafnium(III) iodide vs zirconium(IV) ammonium carbonate dihydrate
name of iridium(V) cation vs mercury(II) cation
PH3 + HClO3 = HCl + H3PO4
phase of propionic acid vs syringic acid
total number of valence electrons of copper(I) cation vs copper(II) cation
I2 + Cr = CrI2
electron configuration group 7 elements
ionic radius of palladium(II) cation vs nickel(III) cation