Search

InChI identifier of chlorpheniramine

Input interpretation

chlorpheniramine | InChI identifier
chlorpheniramine | InChI identifier

Result

InChI=1/C16H19ClN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9, 11, 15H, 10, 12H2, 1-2H3
InChI=1/C16H19ClN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9, 11, 15H, 10, 12H2, 1-2H3

Random Queries

PubChem CID number of fluoxetine vs 9 H-carbazol-2-yl trifluoromethanesulfonate
stable isotopes of magnesium vs aluminum
IUPAC name of sodium chloride vs europium(III) sulfate hydrate
AgNO3 + AlCl3 = AgCl + Al(NO3)3
chemical types of sodium periodate
freezing point of ammonium chloride vs selenium tetrabromide
boiling point of acetyl-1-13 cbromide
MDL number of gray antimony
name of diphenylphosphino ferrocene
relative molecular mass of potassium