Search

SMILES identifier of 3,4-dimethylphenylmagnesium chloride

Input interpretation

3, 4-dimethylphenylmagnesium chloride | SMILES identifier
3, 4-dimethylphenylmagnesium chloride | SMILES identifier

Result

CC1=CC=[C-]C=C1C.[Mg+2].[Cl-]
CC1=CC=[C-]C=C1C.[Mg+2].[Cl-]

Random Queries

O2 + HgS = SO2 + Hg
alternate names of beryllium compound with titanium (12:1) vs potassium periodate
handwritten style Fm-252
alternate names of calcium cation
carbonate anion vs hydride anion vs borate anion vs acetate anion
alternate names of cerium(III) tungstate
density of platinum(IV) oxide vs yttrium(III) perchlorate
molar mass of arsenic trioxide
formula of osmium pentacarbonyl
DOT numbers of nitrosyl chloride