2-bromo-4-fluoroiodobenzene

2-bromo-4-fluoroiodobenzene

formula | BrC_6H_3(F)I Hill formula | C_6H_3BrFI name | 2-bromo-4-fluoroiodobenzene IUPAC name | 2-bromo-4-fluoro-1-iodobenzene alternate names | 2-bromo-4-fluoro-1-iodo-benzene | 2-bromo-4-fluoro-1-iodobenzene mass fractions | Br (bromine) 26.6% | C (carbon) 24% | F (fluorine) 6.31% | H (hydrogen) 1% | I (iodine) 42.2%

Draw the Lewis structure of 2-bromo-4-fluoroiodobenzene. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the bromine (n_Br, val = 7), carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), and iodine (n_I, val = 7) atoms: n_Br, val + 6 n_C, val + n_F, val + 3 n_H, val + n_I, val = 48 Calculate the number of electrons needed to completely fill the valence shells for bromine (n_Br, full = 8), carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), and iodine (n_I, full = 8): n_Br, full + 6 n_C, full + n_F, full + 3 n_H, full + n_I, full = 78 Subtracting these two numbers shows that 78 - 48 = 30 bonding electrons are needed. Each bond has two electrons, so in addition to the 12 bonds already present in the diagram add 3 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 3 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |

3D structure

molar mass | 300.9 g/mol phase | liquid (at STP) boiling point | 224.5 °C density | 2.323 g/cm^3

density | 2.323 g/cm^3 refractive index | 1.628

CAS number | 202865-73-4 PubChem CID number | 2773372 PubChem SID number | 24881497 SMILES identifier | C1=CC(=C(C=C1F)Br)I InChI identifier | InChI=1/C6H3BrFI/c7-5-3-4(8)1-2-6(5)9/h1-3H MDL number | MFCD00142868

flash point | 110 °C