Search

name of 3-methylbenzylmagnesium chloride

Input interpretation

3-methylbenzylmagnesium chloride
3-methylbenzylmagnesium chloride

Chemical names and formulas

formula | CH_3C_6H_4CH_2MgCl Hill formula | C_8H_9ClMg name | 3-methylbenzylmagnesium chloride IUPAC name | magnesium 1-methanidyl-3-methylbenzene chloride alternate names | magnesium 1-methanidyl-3-methyl-benzene chloride | magnesium 1-methanidyl-3-methylbenzene chloride mass fractions | C (carbon) 58.3% | Cl (chlorine) 21.5% | H (hydrogen) 5.5% | Mg (magnesium) 14.7%
formula | CH_3C_6H_4CH_2MgCl Hill formula | C_8H_9ClMg name | 3-methylbenzylmagnesium chloride IUPAC name | magnesium 1-methanidyl-3-methylbenzene chloride alternate names | magnesium 1-methanidyl-3-methyl-benzene chloride | magnesium 1-methanidyl-3-methylbenzene chloride mass fractions | C (carbon) 58.3% | Cl (chlorine) 21.5% | H (hydrogen) 5.5% | Mg (magnesium) 14.7%

Structure diagram

Structure diagram
Structure diagram
vertex count | 10 edge count | 8 Schultz index | 268 Wiener index | 61 Hosoya index | 37 Balaban index | 2.231
vertex count | 10 edge count | 8 Schultz index | 268 Wiener index | 61 Hosoya index | 37 Balaban index | 2.231

Basic properties

molar mass | 164.9 g/mol phase | liquid (at STP) boiling point | 65 °C density | 0.923 g/cm^3
molar mass | 164.9 g/mol phase | liquid (at STP) boiling point | 65 °C density | 0.923 g/cm^3

Units

Liquid properties (at STP)

density | 0.923 g/cm^3
density | 0.923 g/cm^3

Units

Chemical identifiers

CAS number | 29875-06-7 PubChem CID number | 14867646 PubChem SID number | 24880010 SMILES identifier | CC1=CC=CC(=C1)[CH2-].[Mg+2].[Cl-] InChI identifier | InChI=1/C8H9.ClH.Mg/c1-7-4-3-5-8(2)6-7;;/h3-6H, 1H2, 2H3;1H;/q-1;;+2/p-1/fC8H9.Cl.Mg/h;1h;/qm;-1;m MDL number | MFCD01319905
CAS number | 29875-06-7 PubChem CID number | 14867646 PubChem SID number | 24880010 SMILES identifier | CC1=CC=CC(=C1)[CH2-].[Mg+2].[Cl-] InChI identifier | InChI=1/C8H9.ClH.Mg/c1-7-4-3-5-8(2)6-7;;/h3-6H, 1H2, 2H3;1H;/q-1;;+2/p-1/fC8H9.Cl.Mg/h;1h;/qm;-1;m MDL number | MFCD01319905

Safety properties

flash point | -17.22 °C
flash point | -17.22 °C

Random Queries

chemical types lead(II) sulfate
name of indium(III) cation vs thallium(I) cation
H2O + NaOH + Pb = H2 + Na
H2O + HNO2 = H2 + HNO3 + NO
IUPAC name of sodium amide vs trifluoromethanesulfonic acid
discovery year of bromine vs hydrogen
HNO3 + FeS2 = H2O + H2SO4 + NO + Fe2(NO3)3
electron shell configuration of vanadium
chemical uses of silicon nitride
HCl + SnCl2 + HgCl2 = Hg2Cl2 + H2