Input interpretation
3, 5-diformyl-2-fluorophenylboronic acid
Chemical names and formulas
formula | C_8H_6BFO_4 name | 3, 5-diformyl-2-fluorophenylboronic acid IUPAC name | (2-fluoro-3, 5-diformylphenyl)boronic acid alternate names | (2-fluoro-3, 5-diformyl-phenyl)boronic acid | (2-fluoro-3, 5-diformylphenyl)boronic acid | 2-fluoro-3, 5-diformylphenylboronic acid | (2-fluoro-3, 5-dimethanoyl-phenyl)boronic acid mass fractions | B (boron) 5.52% | C (carbon) 49% | F (fluorine) 9.7% | H (hydrogen) 3.09% | O (oxygen) 32.7%
Lewis structure
Draw the Lewis structure of 3, 5-diformyl-2-fluorophenylboronic acid. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the boron (n_B, val = 3), carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: n_B, val + 8 n_C, val + n_F, val + 6 n_H, val + 4 n_O, val = 72 Calculate the number of electrons needed to completely fill the valence shells for boron (n_B, full = 6), carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): n_B, full + 8 n_C, full + n_F, full + 6 n_H, full + 4 n_O, full = 122 Subtracting these two numbers shows that 122 - 72 = 50 bonding electrons are needed. Each bond has two electrons, so in addition to the 20 bonds already present in the diagram add 5 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 5 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |
Basic properties
molar mass | 195.94 g/mol phase | solid (at STP) melting point | 237.5 °C
Units
Chemical identifiers
CAS number | 870778-85-1 PubChem CID number | 16217830 PubChem SID number | 24883401 SMILES identifier | B(C1=CC(=CC(=C1F)C=O)C=O)(O)O InChI identifier | InChI=1/C8H6BFO4/c10-8-6(4-12)1-5(3-11)2-7(8)9(13)14/h1-4, 13-14H MDL number | MFCD08276764