Search

name of manganese(IV) pyrophosphate

Input interpretation

manganese(IV) pyrophosphate
manganese(IV) pyrophosphate

Chemical names and formulas

formula | MnP_2O_7 Hill formula | MnO_7P_2-4 name | manganese(IV) pyrophosphate IUPAC name | dioxido-oxo-phosphonatooxy-phosphorane; manganese alternate names | diphosphoric acid, manganese(4+) salt (1:1) | manganese diphosphate | manganese phosphate | manganese pyrophosphate mass fractions | Mn (manganese) 24% | O (oxygen) 48.9% | P (phosphorus) 27.1%
formula | MnP_2O_7 Hill formula | MnO_7P_2-4 name | manganese(IV) pyrophosphate IUPAC name | dioxido-oxo-phosphonatooxy-phosphorane; manganese alternate names | diphosphoric acid, manganese(4+) salt (1:1) | manganese diphosphate | manganese phosphate | manganese pyrophosphate mass fractions | Mn (manganese) 24% | O (oxygen) 48.9% | P (phosphorus) 27.1%

Structure diagram

Structure diagram
Structure diagram
vertex count | 10 edge count | 8 Schultz index | 322 Wiener index | 88 Hosoya index | 24 Balaban index | 3.746
vertex count | 10 edge count | 8 Schultz index | 322 Wiener index | 88 Hosoya index | 24 Balaban index | 3.746

Basic properties

molar mass | 228.88 g/mol phase | solid (at STP) melting point | 1196 °C density | 3.71 g/cm^3
molar mass | 228.88 g/mol phase | solid (at STP) melting point | 1196 °C density | 3.71 g/cm^3

Units

Solid properties (at STP)

density | 3.71 g/cm^3
density | 3.71 g/cm^3

Units

Chemical identifiers

CAS number | 53731-35-4 PubChem CID number | 171295 SMILES identifier | [O-]P(=O)([O-])OP(=O)([O-])[O-].[Mn] InChI identifier | InChI=1/Mn.H4O7P2/c;1-8(2, 3)7-9(4, 5)6/h;(H2, 1, 2, 3)(H2, 4, 5, 6)/p-4/fMn.O7P2/q;-4 EU number | 258-729-7
CAS number | 53731-35-4 PubChem CID number | 171295 SMILES identifier | [O-]P(=O)([O-])OP(=O)([O-])[O-].[Mn] InChI identifier | InChI=1/Mn.H4O7P2/c;1-8(2, 3)7-9(4, 5)6/h;(H2, 1, 2, 3)(H2, 4, 5, 6)/p-4/fMn.O7P2/q;-4 EU number | 258-729-7

NFPA label

NFPA label
NFPA label
NFPA health rating | 2 NFPA fire rating | 1 NFPA reactivity rating | 0
NFPA health rating | 2 NFPA fire rating | 1 NFPA reactivity rating | 0

Ion equivalents

Mn^(4+) (manganese(IV) cation) | 1 (P_2O_7)^(4-) (diphosphate anion) | 1
Mn^(4+) (manganese(IV) cation) | 1 (P_2O_7)^(4-) (diphosphate anion) | 1