Search

name of cobaltous nitrate

Input interpretation

cobaltous nitrate
cobaltous nitrate

Chemical names and formulas

formula | CoN_2O_6 name | cobaltous nitrate IUPAC name | cobalt(+2) cation dinitrate alternate names | cobalt(2+) nitrate | cobalt dinitrate | cobalt(II) nitrate | cobalt nitrate mass fractions | Co (cobalt) 32.2% | N (nitrogen) 15.3% | O (oxygen) 52.5%
formula | CoN_2O_6 name | cobaltous nitrate IUPAC name | cobalt(+2) cation dinitrate alternate names | cobalt(2+) nitrate | cobalt dinitrate | cobalt(II) nitrate | cobalt nitrate mass fractions | Co (cobalt) 32.2% | N (nitrogen) 15.3% | O (oxygen) 52.5%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 182.94 g/mol phase | solid (at STP) melting point | 55 °C density | 2.49 g/cm^3 solubility in water | soluble
molar mass | 182.94 g/mol phase | solid (at STP) melting point | 55 °C density | 2.49 g/cm^3 solubility in water | soluble

Units

Solid properties (at STP)

density | 2.49 g/cm^3
density | 2.49 g/cm^3

Units

Thermodynamic properties

specific heat of formation Δ_fH° | solid | -2.299 kJ/g molar heat of formation Δ_fH° | solid | -420.5 kJ/mol (at STP)
specific heat of formation Δ_fH° | solid | -2.299 kJ/g molar heat of formation Δ_fH° | solid | -420.5 kJ/mol (at STP)

Chemical identifiers

CAS number | 10141-05-6 PubChem CID number | 25000 SMILES identifier | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Co+2] InChI identifier | InChI=1/Co.2NO3/c;2*2-1(3)4/q+2;2*-1 EU number | 233-402-1 Gmelin number | 20108 RTECS number | GG1109000
CAS number | 10141-05-6 PubChem CID number | 25000 SMILES identifier | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Co+2] InChI identifier | InChI=1/Co.2NO3/c;2*2-1(3)4/q+2;2*-1 EU number | 233-402-1 Gmelin number | 20108 RTECS number | GG1109000

NFPA label

NFPA label
NFPA label
NFPA hazards | oxidizing agent
NFPA hazards | oxidizing agent

Toxicity properties

RTECS classes | tumorigen | reproductive effector
RTECS classes | tumorigen | reproductive effector