Search

name of barium chlorate

Input interpretation

barium chlorate
barium chlorate

Chemical names and formulas

formula | BaCl_2O_6 name | barium chlorate IUPAC name | barium(+2) cation dichlorate alternate names | bA chlorate | chloric acid, barium salt mass fractions | Ba (barium) 45.1% | Cl (chlorine) 23.3% | O (oxygen) 31.6%
formula | BaCl_2O_6 name | barium chlorate IUPAC name | barium(+2) cation dichlorate alternate names | bA chlorate | chloric acid, barium salt mass fractions | Ba (barium) 45.1% | Cl (chlorine) 23.3% | O (oxygen) 31.6%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 304.22 g/mol phase | solid (at STP) melting point | 413.9 °C density | 3.18 g/cm^3
molar mass | 304.22 g/mol phase | solid (at STP) melting point | 413.9 °C density | 3.18 g/cm^3

Units

Solid properties (at STP)

density | 3.18 g/cm^3
density | 3.18 g/cm^3

Units

Chemical identifiers

CAS number | 13477-00-4 PubChem CID number | 26059 SMILES identifier | [O-]Cl(=O)=O.[O-]Cl(=O)=O.[Ba+2] InChI identifier | InChI=1/Ba.2ClHO3/c;2*2-1(3)4/h;2*(H, 2, 3, 4)/q+2;;/p-2/fBa.2ClO3/qm;2*-1 EU number | 236-760-7 Gmelin number | 34842 RTECS number | FN9770000
CAS number | 13477-00-4 PubChem CID number | 26059 SMILES identifier | [O-]Cl(=O)=O.[O-]Cl(=O)=O.[Ba+2] InChI identifier | InChI=1/Ba.2ClHO3/c;2*2-1(3)4/h;2*(H, 2, 3, 4)/q+2;;/p-2/fBa.2ClO3/qm;2*-1 EU number | 236-760-7 Gmelin number | 34842 RTECS number | FN9770000

NFPA label

NFPA label
NFPA label
NFPA health rating | 2 NFPA fire rating | 0 NFPA reactivity rating | 1 NFPA hazards | oxidizing agent
NFPA health rating | 2 NFPA fire rating | 0 NFPA reactivity rating | 1 NFPA hazards | oxidizing agent