2, 2-bis(3-amino-4-hydroxyphenyl)hexafluoropropane

2, 2-bis(3-amino-4-hydroxyphenyl)hexafluoropropane

formula | (F_3C)_2C(C_6H_3(NH_2)OH)_2 Hill formula | C_15H_12F_6N_2O_2 name | 2, 2-bis(3-amino-4-hydroxyphenyl)hexafluoropropane IUPAC name | 2-amino-4-[1-(3-amino-4-hydroxyphenyl)-2, 2, 2-trifluoro-1-(trifluoromethyl)ethyl]phenol alternate names | 2-amino-4-[1-(3-amino-4-hydroxy-phenyl)-2, 2, 2-trifluoro-1-(trifluoromethyl)ethyl]phenol | 2-amino-4-[2-(3-amino-4-hydroxy-phenyl)-1, 1, 1, 3, 3, 3-hexafluoro-propan-2-yl]phenol | 2-amino-4-[2-(3-amino-4-hydroxyphenyl)-1, 1, 1, 3, 3, 3-hexafluoropropan-2-yl]phenol mass fractions | C (carbon) 49.2% | F (fluorine) 31.1% | H (hydrogen) 3.3% | N (nitrogen) 7.65% | O (oxygen) 8.74%

Draw the Lewis structure of 2, 2-bis(3-amino-4-hydroxyphenyl)hexafluoropropane. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: 15 n_C, val + 6 n_F, val + 12 n_H, val + 2 n_N, val + 2 n_O, val = 136 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): 15 n_C, full + 6 n_F, full + 12 n_H, full + 2 n_N, full + 2 n_O, full = 224 Subtracting these two numbers shows that 224 - 136 = 88 bonding electrons are needed. Each bond has two electrons, so in addition to the 38 bonds already present in the diagram add 6 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 6 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom rings are aromatic, so that the single and double bonds may be rearranged: Answer: | |

3D structure

molar mass | 366.26 g/mol phase | solid (at STP) melting point | 246.5 °C

CAS number | 83558-87-6 PubChem CID number | 632603 PubChem SID number | 24878553 SMILES identifier | C1=CC(=C(C=C1C(C2=CC(=C(C=C2)O)N)(C(F)(F)F)C(F)(F)F)N)O InChI identifier | InChI=1/C15H12F6N2O2/c16-14(17, 18)13(15(19, 20)21, 7-1-3-11(24)9(22)5-7)8-2-4-12(25)10(23)6-8/h1-6, 24-25H, 22-23H2 MDL number | MFCD00039147