Input interpretation
triphenylphosphine | ruthenium
Chemical names and formulas
| triphenylphosphine | ruthenium formula | C_18H_15P | Ru Hill formula | C_18H_15P | Ru name | triphenylphosphine | ruthenium IUPAC name | triphenylphosphane | ruthenium alternate names | phosphine, triphenyl- | triphenylphosphane | triphenylphosphide | triphenylphosphorus | ruthenium metal mass fractions | C (carbon) 82.4% | H (hydrogen) 5.76% | P (phosphorus) 11.8% | Ru (ruthenium) 100%
Structure diagrams
Structure diagrams
3D structure
3D structure
Basic properties
| triphenylphosphine | ruthenium molar mass | 262.29 g/mol | 101.07 g/mol phase | solid (at STP) | solid (at STP) melting point | 79 °C | 2310 °C boiling point | 377 °C | 3900 °C density | 1.194 g/cm^3 | 12.37 g/cm^3 solubility in water | insoluble | insoluble
Units
Thermodynamic properties
| triphenylphosphine | ruthenium molar heat of vaporization | 96.2 kJ/mol (kilojoules per mole) | 580 kJ/mol (kilojoules per mole) specific heat of vaporization | 0.3668 kJ/g (kilojoules per gram) | 5.74 kJ/g (kilojoules per gram) molar heat of combustion | 10295 kJ/mol (kilojoules per mole) | molar heat of fusion | 19.7 kJ/mol (kilojoules per mole) | 38.59 kJ/mol (kilojoules per mole) specific heat of fusion | 0.07511 kJ/g (kilojoules per gram) | 0.3818 kJ/g (kilojoules per gram)
Solid properties (at STP)
| triphenylphosphine | ruthenium density | 1.194 g/cm^3 | 12.37 g/cm^3 vapor pressure | 1.13×10^-7 mmHg | refractive index | 1.5918 |
Units
Chemical identifiers
![| triphenylphosphine | ruthenium CAS number | 603-35-0 | 7440-18-8 Beilstein number | 610776 | PubChem CID number | 11776 | 23950 PubChem SID number | | 24852587 SMILES identifier | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3 | [Ru] InChI identifier | InChI=1/C18H15P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H | InChI=1/Ru EU number | 210-036-0 | RTECS number | SZ3500000 | NSC number | 215203 | MDL number | | MFCD00011207](../image_source/ed08e6ee03136a3bfae77beba1d6bc0f.png)
| triphenylphosphine | ruthenium CAS number | 603-35-0 | 7440-18-8 Beilstein number | 610776 | PubChem CID number | 11776 | 23950 PubChem SID number | | 24852587 SMILES identifier | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3 | [Ru] InChI identifier | InChI=1/C18H15P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H | InChI=1/Ru EU number | 210-036-0 | RTECS number | SZ3500000 | NSC number | 215203 | MDL number | | MFCD00011207
NFPA label
NFPA label
| triphenylphosphine NFPA health rating | 0 NFPA fire rating | 1 NFPA reactivity rating | 0