Input interpretation
5-chloro-1-ethyl-2-methylimidazole
Chemical names and formulas
formula | C_6H_9ClN_2 name | 5-chloro-1-ethyl-2-methylimidazole alternate names | 5-chloro-1-ethyl-2-methyl-imidazole mass fractions | C (carbon) 49.8% | Cl (chlorine) 24.5% | H (hydrogen) 6.27% | N (nitrogen) 19.4%
Lewis structure
Draw the Lewis structure of 5-chloro-1-ethyl-2-methylimidazole. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), chlorine (n_Cl, val = 7), hydrogen (n_H, val = 1), and nitrogen (n_N, val = 5) atoms: 6 n_C, val + n_Cl, val + 9 n_H, val + 2 n_N, val = 50 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), chlorine (n_Cl, full = 8), hydrogen (n_H, full = 2), and nitrogen (n_N, full = 8): 6 n_C, full + n_Cl, full + 9 n_H, full + 2 n_N, full = 90 Subtracting these two numbers shows that 90 - 50 = 40 bonding electrons are needed. Each bond has two electrons, so in addition to the 18 bonds already present in the diagram add 2 bonds. To minimize formal charge nitrogen wants 3 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 2 bonds by pairing electrons between adjacent highlighted atoms: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 144.6 g/mol phase | liquid (at STP) boiling point | 101 °C (measured at 1600 Pa) density | 1.141 g/cm^3
Units
Liquid properties (at STP)
density | 1.141 g/cm^3 refractive index | 1.499
Units
Chemical identifiers
CAS number | 4897-22-7 PubChem CID number | 78606 PubChem SID number | 24859843 SMILES identifier | CCN1C(=NC=C1Cl)C InChI identifier | InChI=1/C6H9ClN2/c1-3-9-5(2)8-4-6(9)7/h4H, 3H2, 1-2H3 MDL number | MFCD00074901
Safety properties
flash point | 96.11 °C