Search

InChI identifier of tropicamide

Input interpretation

tropicamide | InChI identifier
tropicamide | InChI identifier

Result

InChI=1/C17H20N2O2/c1-2-19(12-14-8-10-18-11-9-14)17(21)16(13-20)15-6-4-3-5-7-15/h3-11, 16, 20H, 2, 12-13H2, 1H3/t16-/m0/s1
InChI=1/C17H20N2O2/c1-2-19(12-14-8-10-18-11-9-14)17(21)16(13-20)15-6-4-3-5-7-15/h3-11, 16, 20H, 2, 12-13H2, 1H3/t16-/m0/s1

Random Queries

crystal system of andesine vs eifelite
atomic diameter of nitrogen vs hydrogen
CAS number of thulium
Al(OH)3 + SO3 = H2O + Al2(SO4)3
ionization energies of silver vs palladium
chemical types nitrogen dioxide
formula of lithium perchlorate
melting point of synthetic elements
CAS number of bromine vs oxygen
formula of lithium