10-deacetyl-2-debenzoylbaccatin iii

10-deacetyl-2-debenzoylbaccatin iii

formula | C_22H_32O_9 name | 10-deacetyl-2-debenzoylbaccatin iii mass fractions | C (carbon) 60% | H (hydrogen) 7.32% | O (oxygen) 32.7%

Draw the Lewis structure of 10-deacetyl-2-debenzoylbaccatin iii. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 22 n_C, val + 32 n_H, val + 9 n_O, val = 174 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 22 n_C, full + 32 n_H, full + 9 n_O, full = 312 Subtracting these two numbers shows that 312 - 174 = 138 bonding electrons are needed. Each bond has two electrons, so in addition to the 66 bonds already present in the diagram add 3 bonds. To minimize formal charge carbon wants 4 bonds and oxygen wants 2 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 3 bonds by pairing electrons between adjacent highlighted atoms: Answer: | |

molar mass | 440.49 g/mol

PubChem CID number | 443489 SMILES identifier | CC4(C(O)CC3(O)(C(O)[CH]2(C1(COC1CC(O)C(C)2C(=O)C(O)C(C(C)(C)3)=4)(OC(=O)C))))