Search

barium bromate

Input interpretation

barium bromate
barium bromate

Chemical names and formulas

formula | Ba(BrO_3)_2 Hill formula | BaBr_2O_6 name | barium bromate alternate names | barium; bromic acid | bromic acid, barium salt mass fractions | Ba (barium) 34.9% | Br (bromine) 40.7% | O (oxygen) 24.4%
formula | Ba(BrO_3)_2 Hill formula | BaBr_2O_6 name | barium bromate alternate names | barium; bromic acid | bromic acid, barium salt mass fractions | Ba (barium) 34.9% | Br (bromine) 40.7% | O (oxygen) 24.4%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 393.13 g/mol density | 3.99 g/cm^3
molar mass | 393.13 g/mol density | 3.99 g/cm^3

Units

Chemical identifiers

CAS number | 13967-90-3 SMILES identifier | [Ba+2].Br(=O)(=O)[O-].Br(=O)(=O)[O-] RTECS number | EF8715000 MDL number | MFCD00014177
CAS number | 13967-90-3 SMILES identifier | [Ba+2].Br(=O)(=O)[O-].Br(=O)(=O)[O-] RTECS number | EF8715000 MDL number | MFCD00014177

NFPA label

NFPA label
NFPA label
NFPA hazards | oxidizing agent
NFPA hazards | oxidizing agent

Toxicity properties

RTECS classes | other
RTECS classes | other

Random Queries

lanthanum fluoride
InChI identifier of sodium hexafluorozirconate
melting point of 3,5-diiodo-L-tyrosine
net ionic charge of neodymium(III) cation
CID calcium bisulfite
alternate names of ferrotantalite vs loveringite
formula of thiolate functional group vs hydrazone functional group
name of iron(III) cation vs thiocyanate anion
(freezing point of hydrogen chloride)/(boiling point of hydrogen chloride)
( boron(I) cation)