Search

dimenhydrinate

Input interpretation

dimenhydrinate
dimenhydrinate

Chemical names and formulas

formula | C_24H_28ClN_5O_3 name | dimenhydrinate IUPAC name | 2-benzhydryloxyethyl-dimethyl-azanium; 8-chloro-1, 3-dimethyl-2-oxo-purin-6-olate alternate names | andramine | chloranautine | dramamine mass fractions | C (carbon) 61.3% | Cl (chlorine) 7.54% | H (hydrogen) 6.01% | N (nitrogen) 14.9% | O (oxygen) 10.2%
formula | C_24H_28ClN_5O_3 name | dimenhydrinate IUPAC name | 2-benzhydryloxyethyl-dimethyl-azanium; 8-chloro-1, 3-dimethyl-2-oxo-purin-6-olate alternate names | andramine | chloranautine | dramamine mass fractions | C (carbon) 61.3% | Cl (chlorine) 7.54% | H (hydrogen) 6.01% | N (nitrogen) 14.9% | O (oxygen) 10.2%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 470 g/mol phase | solid (at STP) melting point | 105 °C
molar mass | 470 g/mol phase | solid (at STP) melting point | 105 °C

Units

Hydrophobicity and permeability properties

experimental LogP hydrophobicity | -0.39 predicted LogP hydrophobicity | 2.71 predicted LogS | -5.43
experimental LogP hydrophobicity | -0.39 predicted LogP hydrophobicity | 2.71 predicted LogS | -5.43

Drug interactions

donepezil | galantamine | rivastigmine (total: 3)
donepezil | galantamine | rivastigmine (total: 3)

Basic drug properties

approval status | approved | small molecule drug categories | antiemetic | histamine h1 antagonist dosage forms | oral: capsule | intramuscular: liquid | intravenous: liquid | oral: liquid | intramuscular: solution | intravenous: solution | rectal: suppository | oral: syrup | oral: tablet | oral: tablet, multilayer
approval status | approved | small molecule drug categories | antiemetic | histamine h1 antagonist dosage forms | oral: capsule | intramuscular: liquid | intravenous: liquid | oral: liquid | intramuscular: solution | intravenous: solution | rectal: suppository | oral: syrup | oral: tablet | oral: tablet, multilayer
brand names | amosyt | anautine | andramine | antemin | aviomarin | chloranautine | diamarin | dimate | dimenest | dimentabs | dramalen | dramamin | dramarin | dramilin | dramyl | dromyl | eldodram | gravinol | gravol | hydrinate | menhydrinate | neo-navigan | novamine | permital | reise-engletten | supremal | teodramin | travelin | travelmin | troversin | vomex A | xamamina
brand names | amosyt | anautine | andramine | antemin | aviomarin | chloranautine | diamarin | dimate | dimenest | dimentabs | dramalen | dramamin | dramarin | dramilin | dramyl | dromyl | eldodram | gravinol | gravol | hydrinate | menhydrinate | neo-navigan | novamine | permital | reise-engletten | supremal | teodramin | travelin | travelmin | troversin | vomex A | xamamina

Chemical identifiers

CAS number | 523-87-5 Beilstein number | 4121049 PubChem CID number | 441281 PubChem SID number | 7847586 SMILES identifier | CN1C(=C2C(=NC(=N2)Cl)N(C1=O)C)[O-].C[NH+](C)CCOC(C1=CC=CC=C1)C2=CC=CC=C2 InChI identifier | InChI=1/C17H21NO.C7H7ClN4O2/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h3-12, 17H, 13-14H2, 1-2H3;13H, 1-2H3/fC17H22NO.C7H6ClN4O2/h18H;13h/q+1;-1 InChI key | KKRAMGIVRBZVCD-SSIDTSSPCL EU number | 208-350-8 RTECS number | XH5082000 NSC number | 117855
CAS number | 523-87-5 Beilstein number | 4121049 PubChem CID number | 441281 PubChem SID number | 7847586 SMILES identifier | CN1C(=C2C(=NC(=N2)Cl)N(C1=O)C)[O-].C[NH+](C)CCOC(C1=CC=CC=C1)C2=CC=CC=C2 InChI identifier | InChI=1/C17H21NO.C7H7ClN4O2/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h3-12, 17H, 13-14H2, 1-2H3;13H, 1-2H3/fC17H22NO.C7H6ClN4O2/h18H;13h/q+1;-1 InChI key | KKRAMGIVRBZVCD-SSIDTSSPCL EU number | 208-350-8 RTECS number | XH5082000 NSC number | 117855

Toxicity properties

RTECS classes | drug | mutagen | human data
RTECS classes | drug | mutagen | human data