Search

SMILES identifier of firefly luciferin

Input interpretation

firefly luciferin | SMILES identifier
firefly luciferin | SMILES identifier

Result

C1C(NC(=C2N=C3C=CC(=O)C=C3S2)S1)C(=O)O
C1C(NC(=C2N=C3C=CC(=O)C=C3S2)S1)C(=O)O

Random Queries

DOT numbers of ammonium hexabromoplatinate
molar mass of buckminsterfullerene
HNO3 + KMnO4 + BaSO3 = H2O + KNO3 + BaSO4 + Mn(NO3)2
molar mass of silver(II) cation vs palladium(IV) cation
common sources of ion of copper(I) cation vs silver(I) cation
vertex coordinates of benzene vs toluene
chemical types beryllium hydride
chemical types of gray selenium vs activated charcoal
tetrabromobisphenol a bis(2-hydroxyethyl) ether
ions of cesium perchlorate vs potassium nitrate