Input interpretation
2-cyanobenzenesulfonamide
Chemical names and formulas
formula | NCC_6H_4SO_2NH_2 Hill formula | C_7H_6N_2O_2S name | 2-cyanobenzenesulfonamide mass fractions | C (carbon) 46.1% | H (hydrogen) 3.32% | N (nitrogen) 15.4% | O (oxygen) 17.6% | S (sulfur) 17.6%
Lewis structure
Draw the Lewis structure of 2-cyanobenzenesulfonamide. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), oxygen (n_O, val = 6), and sulfur (n_S, val = 6) atoms: 7 n_C, val + 6 n_H, val + 2 n_N, val + 2 n_O, val + n_S, val = 62 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), oxygen (n_O, full = 8), and sulfur (n_S, full = 8): 7 n_C, full + 6 n_H, full + 2 n_N, full + 2 n_O, full + n_S, full = 108 Subtracting these two numbers shows that 108 - 62 = 46 bonding electrons are needed. Each bond has two electrons, so in addition to the 18 bonds already present in the diagram we expect to add 5 bonds. To minimize formal charge oxygen wants 2 bonds, nitrogen wants 3 bonds, and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Add 5 bonds by pairing electrons between adjacent highlighted atoms. Additionally, atoms with large electronegativities can minimize their formal charge by forcing atoms with smaller electronegativities on period 3 or higher to expand their valence shells. The electronegativities of the atoms are 2.20 (hydrogen), 2.55 (carbon), 2.58 (sulfur), 3.04 (nitrogen), and 3.44 (oxygen). Because the electronegativity of sulfur is smaller than the electronegativity of oxygen, expand the valence shell of sulfur to 6 bonds. Therefore we add a total of 7 bonds to the diagram. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 182.2 g/mol phase | solid (at STP) melting point | 162 °C
Units
Chemical identifiers
CAS number | 73542-86-6 PubChem CID number | 1511075 PubChem SID number | 24880118 SMILES identifier | C1=CC=C(C(=C1)C#N)S(=O)(=O)N InChI identifier | InChI=1/C7H6N2O2S/c8-5-6-3-1-2-4-7(6)12(9, 10)11/h1-4H, (H2, 9, 10, 11)/f/h9H2 MDL number | MFCD03094593