Search

name of phthalimide-15 npotassium salt

Input interpretation

phthalimide-15 npotassium salt
phthalimide-15 npotassium salt

Chemical names and formulas

formula | K^15NO_2CC_6H_4 Hill formula | C_8H_4K(15N)O_2 name | phthalimide-15 npotassium salt IUPAC name | potassium isoindolin-2-ide-1, 3-dione alternate names | 1, 3-dihydro-1, 3-dioxoisoindole-15N | potassium isoindol-2-ide-1, 3-dione | potassium isoindolin-2-ide-1, 3-dione | potassium isoindolin-2-ide-1, 3-quinone | potassium phthalimide-15N mass fractions | K (potassium) 0.21% | O (oxygen) 0.172% | N (nitrogen) 0.0806% | C (carbon) 0.516% | H (hydrogen) 0.0217%
formula | K^15NO_2CC_6H_4 Hill formula | C_8H_4K(15N)O_2 name | phthalimide-15 npotassium salt IUPAC name | potassium isoindolin-2-ide-1, 3-dione alternate names | 1, 3-dihydro-1, 3-dioxoisoindole-15N | potassium isoindol-2-ide-1, 3-dione | potassium isoindolin-2-ide-1, 3-dione | potassium isoindolin-2-ide-1, 3-quinone | potassium phthalimide-15N mass fractions | K (potassium) 0.21% | O (oxygen) 0.172% | N (nitrogen) 0.0806% | C (carbon) 0.516% | H (hydrogen) 0.0217%

Structure diagram

Structure diagram
Structure diagram
vertex count | 12 edge count | 12 Schultz index | 626 Wiener index | 137 Hosoya index | 197 Balaban index | 2.072
vertex count | 12 edge count | 12 Schultz index | 626 Wiener index | 137 Hosoya index | 197 Balaban index | 2.072

Basic properties

molar mass | 186.22 g/mol phase | solid (at STP) melting point | 300 °C
molar mass | 186.22 g/mol phase | solid (at STP) melting point | 300 °C

Units

Non-standard atom properties

N-15 | 1
N-15 | 1

Chemical identifiers

CAS number | 53510-88-6 Beilstein number | 3639404 PubChem CID number | 11126984 PubChem SID number | 24858028 SMILES identifier | C1=CC=C2C(=C1)C(=O)[N-]C2=O.[K+] InChI identifier | InChI=1/C8H5NO2.K/c10-7-5-3-1-2-4-6(5)8(11)9-7;/h1-4H, (H, 9, 10, 11);/q;+1/p-1/i9+1;/fC8H4NO2.K/q-1;m MDL number | MFCD00064344
CAS number | 53510-88-6 Beilstein number | 3639404 PubChem CID number | 11126984 PubChem SID number | 24858028 SMILES identifier | C1=CC=C2C(=C1)C(=O)[N-]C2=O.[K+] InChI identifier | InChI=1/C8H5NO2.K/c10-7-5-3-1-2-4-6(5)8(11)9-7;/h1-4H, (H, 9, 10, 11);/q;+1/p-1/i9+1;/fC8H4NO2.K/q-1;m MDL number | MFCD00064344