Search

name of holmium(III) carbonate hydrate

Input interpretation

holmium(III) carbonate hydrate
holmium(III) carbonate hydrate

Chemical names and formulas

formula | Ho_2(CO_3)_3·xH_2O Hill formula | CH_4HoO_4 name | holmium(III) carbonate hydrate IUPAC name | carbonic acid; holmium; hydrate alternate names | carbonic acid; holmium; hydrate mass fractions | C (carbon) 4.9% | H (hydrogen) 1.65% | Ho (holmium) 67.3% | O (oxygen) 26.1%
formula | Ho_2(CO_3)_3·xH_2O Hill formula | CH_4HoO_4 name | holmium(III) carbonate hydrate IUPAC name | carbonic acid; holmium; hydrate alternate names | carbonic acid; holmium; hydrate mass fractions | C (carbon) 4.9% | H (hydrogen) 1.65% | Ho (holmium) 67.3% | O (oxygen) 26.1%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 244.97 g/mol
molar mass | 244.97 g/mol

Units

Chemical identifiers

CAS number | 38245-34-0 PubChem CID number | 16212058 PubChem SID number | 24859527 SMILES identifier | C(=O)(O)O.O.[Ho] InChI identifier | InChI=1/CH2O3.Ho.H2O/c2-1(3)4;;/h(H2, 2, 3, 4);;1H2/f/h2-3H;; MDL number | MFCD00149952
CAS number | 38245-34-0 PubChem CID number | 16212058 PubChem SID number | 24859527 SMILES identifier | C(=O)(O)O.O.[Ho] InChI identifier | InChI=1/CH2O3.Ho.H2O/c2-1(3)4;;/h(H2, 2, 3, 4);;1H2/f/h2-3H;; MDL number | MFCD00149952

Random Queries

boiling point of N-heptane vs methylcyclohexane
ionic radius of cobalt(III) ions
mass fractions of cadmium dichromate monohydrate
Hill formula of tin(IV) sulfide vs lithium hexafluorophosphate
HMnO4 = H2O + O2 + MnO2
chemical uses of tungsten carbide
density of carbon vs nitrogen
molar mass of hexaamminecobalt(II) cation vs cobalt(III) cation
freezing point of sodium phosphotungstate hydrate
common sources of ion of nickel(II) cation