Search

InChI identifier of (2-methyl-1-propenyl)benzene

Input interpretation

(2-methyl-1-propenyl)benzene | InChI identifier
(2-methyl-1-propenyl)benzene | InChI identifier

Result

InChI=1/C10H12/c1-9(2)8-10-6-4-3-5-7-10/h3-8H, 1-2H3
InChI=1/C10H12/c1-9(2)8-10-6-4-3-5-7-10/h3-8H, 1-2H3

Random Queries

first ionization energies of group 16 elements
atomic number of selenium vs bromine
melting point of 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluorododecyl acrylate vs ethylα-cyano-4-fluorocinnamate
empirical formula of hexamethylmelamine
4,4'-(1-phenylethylidene)bisphenol
melting point of hydrogen sulfide vs sulfuric acid
phase at STP of thallium
molar mass of iron(II) oxide vs lutetium(III) oxide
H2O + Ca(CO3) = CaO + H2CO3
uranium tetrabromide