Search

name of ammonium-d 8sulfate

Input interpretation

ammonium-d 8sulfate
ammonium-d 8sulfate

Chemical names and formulas

formula | (ND_4)_2SO_4 Hill formula | D_8N_2O_4S name | ammonium-d 8sulfate IUPAC name | tetradeuterioammonium sulfate alternate names | tetradeuterioammonium sulfate | tetradeuterioazanium sulfate mass fractions | S (sulfur) 0.229% | O (oxygen) 0.457% | N (nitrogen) 0.2% | H (hydrogen) 0.115%
formula | (ND_4)_2SO_4 Hill formula | D_8N_2O_4S name | ammonium-d 8sulfate IUPAC name | tetradeuterioammonium sulfate alternate names | tetradeuterioammonium sulfate | tetradeuterioazanium sulfate mass fractions | S (sulfur) 0.229% | O (oxygen) 0.457% | N (nitrogen) 0.2% | H (hydrogen) 0.115%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 140.18 g/mol phase | solid (at STP) melting point | 280 °C solubility in water | soluble
molar mass | 140.18 g/mol phase | solid (at STP) melting point | 280 °C solubility in water | soluble

Units

Non-standard atom properties

H-2 | 8
H-2 | 8

Chemical identifiers

CAS number | 13814-01-2 PubChem CID number | 16211390 PubChem SID number | 24850522 SMILES identifier | [NH4+].[NH4+].[O-]S(=O)(=O)[O-] InChI identifier | InChI=1/2H3N.H2O4S/c;;1-5(2, 3)4/h2*1H3;(H2, 1, 2, 3, 4)/i/hD8/f2H4N.O4S/h2*1H;/q2*+1;-2/i2*1D4; MDL number | MFCD00084116
CAS number | 13814-01-2 PubChem CID number | 16211390 PubChem SID number | 24850522 SMILES identifier | [NH4+].[NH4+].[O-]S(=O)(=O)[O-] InChI identifier | InChI=1/2H3N.H2O4S/c;;1-5(2, 3)4/h2*1H3;(H2, 1, 2, 3, 4)/i/hD8/f2H4N.O4S/h2*1H;/q2*+1;-2/i2*1D4; MDL number | MFCD00084116

Ion equivalents

(NH_4)^+ (ammonium cation) | 2 (SO_4)^(2-) (sulfate anion) | 1
(NH_4)^+ (ammonium cation) | 2 (SO_4)^(2-) (sulfate anion) | 1