name of antimony pentachloride vs zinc niobate

antimony pentachloride | zinc niobate

| antimony pentachloride | zinc niobate formula | SbCl_5 | Zn(NbO_3)_2 Hill formula | Cl_5Sb | Nb_2O_6Zn name | antimony pentachloride | zinc niobate IUPAC name | pentachlorostiborane | zinc oxido-dioxoniobium alternate names | antimony chloride | antimony perchloride | antimony(V) chloride | pentachlorostiborane | zinc diketo-oxido-niobium | zinc oxido-dioxo-niobium | zinc oxido-dioxoniobium mass fractions | Cl (chlorine) 59.3% | Sb (antimony) 40.7% | Nb (niobium) 53.5% | O (oxygen) 27.6% | Zn (zinc) 18.8%

Structure diagrams

| antimony pentachloride | zinc niobate molar mass | 299 g/mol | 347.19 g/mol phase | liquid (at STP) | solid (at STP) melting point | 2.8 °C | 300 °C boiling point | 92 °C | density | 2.36 g/cm^3 | solubility in water | soluble |

| antimony pentachloride density | 2.36 g/cm^3 vapor pressure | 6.721 mmHg dynamic viscosity | 0.00191 Pa s refractive index | 1.59255

| antimony pentachloride molar heat of vaporization | 48.4 kJ/mol (kilojoules per mole) specific heat of vaporization | 0.162 kJ/g (kilojoules per gram) molar heat of fusion | 10.05 kJ/mol (kilojoules per mole)

| antimony pentachloride | zinc niobate CAS number | 7647-18-9 | 12201-66-0 PubChem CID number | 24294 | 16217088 PubChem SID number | 24852875 | 24879043 SMILES identifier | Cl[Sb](Cl)(Cl)(Cl)Cl | [O-][Nb](=O)=O.[O-][Nb](=O)=O.[Zn+2]