Input interpretation
1-phenylcyclohexene
Chemical names and formulas
formula | C_6H_5C_6H_9 Hill formula | C_12H_14 name | 1-phenylcyclohexene IUPAC name | 1-cyclohexenylbenzene alternate names | 1-cyclohexen-1-ylbenzene | 1-cyclohexenylbenzene | 1-phenyl-1-cyclohexene | 1-phenylcyclohex-1-ene | benzene, 1-cyclohexen-1-yl- mass fractions | C (carbon) 91.1% | H (hydrogen) 8.92%
Lewis structure
Draw the Lewis structure of 1-phenylcyclohexene. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4) and hydrogen (n_H, val = 1) atoms: 12 n_C, val + 14 n_H, val = 62 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8) and hydrogen (n_H, full = 2): 12 n_C, full + 14 n_H, full = 124 Subtracting these two numbers shows that 124 - 62 = 62 bonding electrons are needed. Each bond has two electrons, so in addition to the 27 bonds already present in the diagram add 4 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 4 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 158.24 g/mol phase | liquid (at STP) melting point | -11 °C boiling point | 252 °C density | 0.994 g/cm^3 solubility in water | insoluble
Units
Liquid properties (at STP)
density | 0.994 g/cm^3 vapor pressure | 0.032 mmHg (at 25 °C) refractive index | 1.57
Units
Thermodynamic properties
molar heat of vaporization | 47 kJ/mol specific heat of vaporization | 0.297 kJ/g molar heat of combustion | 6716 kJ/mol specific heat of combustion | 42.44 kJ/g (at STP)
Chemical identifiers
CAS number | 771-98-2 PubChem CID number | 13043 PubChem SID number | 24898294 SMILES identifier | C1CCC(=CC1)C2=CC=CC=C2 InChI identifier | InChI=1/C12H14/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1, 3-4, 7-9H, 2, 5-6, 10H2 RTECS number | GW6600000 MDL number | MFCD00001542
NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 1 NFPA reactivity rating | 0
Safety properties
flash point | 103.3 °C
Toxicity properties
RTECS classes | other