Input interpretation
methoxyacetyl chloride
Chemical names and formulas
formula | CH_3OCH_2COCl Hill formula | C_3H_5ClO_2 name | methoxyacetyl chloride IUPAC name | 2-methoxyacetyl chloride alternate names | 2-methoxyacetyl chloride | 2-methoxyethanoyl chloride | acetyl chloride, methoxy- | a-methoxyacetyl chloride | methoxyacetic acid chloride mass fractions | C (carbon) 33.2% | Cl (chlorine) 32.7% | H (hydrogen) 4.64% | O (oxygen) 29.5%
Lewis structure
Draw the Lewis structure of methoxyacetyl chloride. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), chlorine (n_Cl, val = 7), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 3 n_C, val + n_Cl, val + 5 n_H, val + 2 n_O, val = 36 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), chlorine (n_Cl, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 3 n_C, full + n_Cl, full + 5 n_H, full + 2 n_O, full = 58 Subtracting these two numbers shows that 58 - 36 = 22 bonding electrons are needed. Each bond has two electrons, so in addition to the 10 bonds already present in the diagram add 1 bond. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 1 bond by pairing electrons between adjacent highlighted atoms: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 108.5 g/mol phase | liquid (at STP) melting point | -40 °C boiling point | 112.5 °C density | 1.187 g/cm^3 solubility in water | soluble
Units
Liquid properties (at STP)
density | 1.187 g/cm^3 vapor pressure | 22 mmHg (at 25 °C) refractive index | 1.419
Units
Thermodynamic properties
molar heat of vaporization | 35.1 kJ/mol specific heat of vaporization | 0.323 kJ/g (at STP)
Chemical identifiers
CAS number | 38870-89-2 Beilstein number | 1740244 PubChem CID number | 96623 PubChem SID number | 24897347 SMILES identifier | COCC(=O)Cl InChI identifier | InChI=1/C3H5ClO2/c1-6-2-3(4)5/h2H2, 1H3 MDL number | MFCD00000728
Safety properties
flash point | 28.89 °C
DOT hazard class | 8 DOT numbers | 2920