Input interpretation
pantolactone
Chemical names and formulas
formula | C_6H_10O_3 name | pantolactone IUPAC name | (3R)-3-hydroxy-4, 4-dimethyl-2-tetrahydrofuranone alternate names | 2(3H)-furanone, dihydro-3-hydroxy-4, 4-dimethyl-, (3R)- | (-)-2-hydroxy-3, 3-dimethyl-g-butyrolactone | (3R)-3-hydroxy-4, 4-dimethyl-oxolan-2-one | (3R)-3-hydroxy-4, 4-dimethyloxolan-2-one | (3R)-3-hydroxy-4, 4-dimethyl-tetrahydrofuran-2-one | D-(-)-pantolactone | pantoic acid γ-lactone | pantoyl lactone | (R)-(-)-pantolactone | (R)-(-)-α-hydroxy-β, β-dimethyl-γ-butyrolactone | (R)-(-)-β, β-dimethyl-α-hydroxy-γ-butyrolactone mass fractions | C (carbon) 55.4% | H (hydrogen) 7.75% | O (oxygen) 36.9%
Lewis structure
Draw the Lewis structure of pantolactone. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 6 n_C, val + 10 n_H, val + 3 n_O, val = 52 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 6 n_C, full + 10 n_H, full + 3 n_O, full = 92 Subtracting these two numbers shows that 92 - 52 = 40 bonding electrons are needed. Each bond has two electrons, so in addition to the 19 bonds already present in the diagram add 1 bond. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 1 bond by pairing electrons between adjacent highlighted atoms: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 130.14 g/mol phase | solid (at STP) melting point | 91 °C boiling point | 121 °C (measured at 2000 Pa) solubility in water | very soluble
Units
Solid properties (at STP)
vapor pressure | 0.015 mmHg (at 25 °C)
Units
Thermodynamic properties
molar heat of vaporization | 54 kJ/mol specific heat of vaporization | 0.415 kJ/g (at STP)
Chemical identifiers
CAS number | 599-04-2 Beilstein number | 80957 PubChem CID number | 439368 PubChem SID number | 24854272 SMILES identifier | CC1(COC(=O)C1O)C InChI identifier | InChI=1/C6H10O3/c1-6(2)3-9-5(8)4(6)7/h4, 7H, 3H2, 1-2H3/t4-/m0/s1 MDL number | MFCD00005392
NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0
Safety properties
flash point | 99 °C