Search

name of tetrabutylphosphonium chloride

Input interpretation

tetrabutylphosphonium chloride
tetrabutylphosphonium chloride

Chemical names and formulas

formula | (CH_3CH_2CH_2CH_2)_4P(Cl) Hill formula | C_16ClH_36P name | tetrabutylphosphonium chloride alternate names | tetrabutylphosphanium hydrochloride | tetrabutylphosphonium hydrochloride mass fractions | C (carbon) 65.2% | Cl (chlorine) 12% | H (hydrogen) 12.3% | P (phosphorus) 10.5%
formula | (CH_3CH_2CH_2CH_2)_4P(Cl) Hill formula | C_16ClH_36P name | tetrabutylphosphonium chloride alternate names | tetrabutylphosphanium hydrochloride | tetrabutylphosphonium hydrochloride mass fractions | C (carbon) 65.2% | Cl (chlorine) 12% | H (hydrogen) 12.3% | P (phosphorus) 10.5%

Structure diagram

Structure diagram
Structure diagram
vertex count | 18 edge count | 16 Schultz index | 2036 Wiener index | 560 Hosoya index | 2125 Balaban index | 4.391
vertex count | 18 edge count | 16 Schultz index | 2036 Wiener index | 560 Hosoya index | 2125 Balaban index | 4.391

Basic properties

molar mass | 294.89 g/mol phase | solid (at STP) melting point | 64 °C
molar mass | 294.89 g/mol phase | solid (at STP) melting point | 64 °C

Units

Chemical identifiers

CAS number | 2304-30-5 Beilstein number | 4019186 SMILES identifier | CCCC[P+](CCCC)(CCCC)CCCC.[Cl-] RTECS number | TA2419000 MDL number | MFCD00011854
CAS number | 2304-30-5 Beilstein number | 4019186 SMILES identifier | CCCC[P+](CCCC)(CCCC)CCCC.[Cl-] RTECS number | TA2419000 MDL number | MFCD00011854