Search

strontium hexaboride

Input interpretation

strontium hexaboride
strontium hexaboride

Chemical names and formulas

formula | SrB_6 Hill formula | B_6Sr name | strontium hexaboride mass fractions | B (boron) 42.5% | Sr (strontium) 57.5%
formula | SrB_6 Hill formula | B_6Sr name | strontium hexaboride mass fractions | B (boron) 42.5% | Sr (strontium) 57.5%

Structure diagram

Structure diagram
Structure diagram
vertex count | 7 edge count | 8 Schultz index | 164 Wiener index | 23 Hosoya index | 25 Balaban index | 2.151
vertex count | 7 edge count | 8 Schultz index | 164 Wiener index | 23 Hosoya index | 25 Balaban index | 2.151

Basic properties

molar mass | 152.5 g/mol density | 3.39 g/cm^3
molar mass | 152.5 g/mol density | 3.39 g/cm^3

Units

Chemical identifiers

CAS number | 12046-54-7 PubChem CID number | 16212527 PubChem SID number | 24864614 SMILES identifier | [B-]1B2B1B3B2[B-]3.[Sr+2] InChI identifier | InChI=1/B6.Sr/c1-3-4(1)6-2-5(3)6;/q-2;+2 MDL number | MFCD01310211
CAS number | 12046-54-7 PubChem CID number | 16212527 PubChem SID number | 24864614 SMILES identifier | [B-]1B2B1B3B2[B-]3.[Sr+2] InChI identifier | InChI=1/B6.Sr/c1-3-4(1)6-2-5(3)6;/q-2;+2 MDL number | MFCD01310211

Random Queries

density of potassium hydroxide vs nitric acid
atomic mass of xenon vs ruthenium
isomeric SMILES identifier DOT
stable isotopes of osmium
alternate names of barium N-acetylneuraminate vs 1-ethyl-2-pyrrolidinemethanamine
iron(II) phosphate octahydrate vs iron(III) nitrate hexahydrate
freezing point of brackish water
molar heat capacity of sodium cation
names of creatine phosphate
formula of diamminesilver(I) cation