Input interpretation
sucrose | β-D-fructopyranose
Chemical names and formulas
| sucrose | β-D-fructopyranose formula | C_12H_22O_11 | C_6H_12O_6 Hill formula | C_12H_22O_11 | C_6H_12O_6 name | sucrose | β-D-fructopyranose IUPAC name | (2R, 3S, 4S, 5S, 6R)-2-[(2S, 3S, 4S, 5R)-3, 4-dihydroxy-2, 5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3, 4, 5-triol | (2R, 3S, 4R, 5R)-2-(hydroxymethyl)oxane-2, 3, 4, 5-tetrol alternate names | beet sugar | cane sugar | saccharose | table sugar | fructose | fructosteril | fruit sugar | frutabs | laevoral mass fractions | C (carbon) 42.1% | H (hydrogen) 6.48% | O (oxygen) 51.4% | C (carbon) 40% | H (hydrogen) 6.71% | O (oxygen) 53.3%
Structure diagrams
| sucrose | β-D-fructopyranose vertex count | 23 | 12 edge count | 32 | 17 Schultz index | 4473 | 714 Wiener index | 1110 | 178 Hosoya index | 40445 | 203 Balaban index | 2.177 | 2.706
3D structure
3D structure
Basic properties
| sucrose | β-D-fructopyranose molar mass | 342.3 g/mol | 180.16 g/mol phase | solid (at STP) | solid (at STP) melting point | 170 °C | 104 °C boiling point | | 401 °C density | 1.59 g/cm^3 | solubility in water | | soluble
Units
Hydrophobicity and permeability properties
| sucrose | β-D-fructopyranose experimental LogP hydrophobicity | -3.7 | predicted LogP hydrophobicity | -2.63 | -2.5 predicted LogS | 0.38 | 0.82 experimental Caco-2 permeability | -5.77 |
Thermodynamic properties
| sucrose | β-D-fructopyranose molar heat of vaporization | 116.7 kJ/mol (kilojoules per mole) | 75.4 kJ/mol (kilojoules per mole) specific heat of vaporization | 0.3409 kJ/g (kilojoules per gram) | 0.419 kJ/g (kilojoules per gram) molar heat of combustion | 2233 kJ/mol (kilojoules per mole) | 2812 kJ/mol (kilojoules per mole) specific heat of combustion | 6.524 kJ/g (kilojoules per gram) | 15.61 kJ/g (kilojoules per gram) molar heat of fusion | 44.53 kJ/mol (kilojoules per mole) |
Solid properties (at STP)
| sucrose | β-D-fructopyranose density | 1.59 g/cm^3 | vapor pressure | 2×10^-22 mmHg | 4×10^-8 mmHg refractive index | 1.5376 | 1.5101
Units
Chemical identifiers
| sucrose | β-D-fructopyranose CAS number | 57-50-1 | 7660-25-5 Beilstein number | 90825 | 1423189 PubChem CID number | 7566553 | 24310 PubChem SID number | 3389 | 10318401 SMILES identifier | C(C1C(C(C(C(O1)OC2(C(C(C(O2)CO)O)O)CO)O)O)O)O | C1C(C(C(C(O1)(CO)O)O)O)O