Search

name of lead(II) chlorite

Input interpretation

lead(II) chlorite
lead(II) chlorite

Chemical names and formulas

formula | Pb(ClO_2)_2 Hill formula | Cl_2O_4Pb_1 name | lead(II) chlorite mass fractions | Cl (chlorine) 20.7% | O (oxygen) 18.7% | Pb (lead) 60.6%
formula | Pb(ClO_2)_2 Hill formula | Cl_2O_4Pb_1 name | lead(II) chlorite mass fractions | Cl (chlorine) 20.7% | O (oxygen) 18.7% | Pb (lead) 60.6%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 342.1 g/mol solubility in water | slightly soluble
molar mass | 342.1 g/mol solubility in water | slightly soluble

Units

Chemical identifiers

CAS number | 13453-57-1 SMILES identifier | Cl(=O)[O-].Cl(=O)[O-].[Pb+2]
CAS number | 13453-57-1 SMILES identifier | Cl(=O)[O-].Cl(=O)[O-].[Pb+2]

Random Queries

vertex types of lithium bis(trimethylsilyl)amide vs methylmagnesium chloride
flerovium and livermorium
ion class of hexaaquamanganese(II) cation vs hexaaquacobalt(II) cation
Ca + CuCl2 = Cu + CaCl2
drug interactions of acarbose
formula of N-butylbenzene vs 1,6,7-trimethylnaphthalene
IUPAC name of tetrasodium ethylenediaminetetraacetate
density of sodium vs cesium
boiling point of nickel vs silver
Br2 + Cl