hybridization of 1,2,3,4,5-pentaphenyl-1,3-cyclopentadiene

1, 2, 3, 4, 5-pentaphenyl-1, 3-cyclopentadiene | orbital hybridization

First draw the structure diagram for 1, 2, 3, 4, 5-pentaphenyl-1, 3-cyclopentadiene, and for every non-hydrogen atom, count the σ-bonds. Note that double and triple bonds consist of one σ-bond together with one or two π-bonds: For 1, 2, 3, 4, 5-pentaphenyl-1, 3-cyclopentadiene there are no lone pairs, so the steric number is given by the σ-bond count. Consult the following chart to determine the hybridization from the steric number: steric number | hybridization 2 | sp 3 | sp^2 4 | sp^3 5 | dsp^3 6 | d^2sp^3 7 | d^3sp^3 Now assign the hybridization for each atom: Answer: | |

molar mass | 446.6 g/mol formula | C_35H_26 SMILES identifier | C1=CC=C(C=C1)C2C(=C(C3=CC=CC=C3)C(=C2C4=CC=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6 InChI identifier | InChI=1/C35H26/c1-6-16-26(17-7-1)31-32(27-18-8-2-9-19-27)34(29-22-12-4-13-23-29)35(30-24-14-5-15-25-30)33(31)28-20-10-3-11-21-28/h1-25, 31H InChI key | YGLVWOUNCXBPJF-UHFFFAOYSA-N