Search

name of aurothioglucose

Input interpretation

aurothioglucose
aurothioglucose

Chemical names and formulas

formula | C_6H_11AuO_5S name | aurothioglucose IUPAC name | gold(+1) cation; (2R, 3R, 4S, 5S, 6R)-3, 4, 5-trihydroxy-6-(hydroxymethyl)oxane-2-thiolate alternate names | (a-D-glucopyranosylthio)gold | auromyose | solganal mass fractions | Au (gold) 50.2% | C (carbon) 18.4% | H (hydrogen) 2.83% | O (oxygen) 20.4% | S (sulfur) 8.17%
formula | C_6H_11AuO_5S name | aurothioglucose IUPAC name | gold(+1) cation; (2R, 3R, 4S, 5S, 6R)-3, 4, 5-trihydroxy-6-(hydroxymethyl)oxane-2-thiolate alternate names | (a-D-glucopyranosylthio)gold | auromyose | solganal mass fractions | Au (gold) 50.2% | C (carbon) 18.4% | H (hydrogen) 2.83% | O (oxygen) 20.4% | S (sulfur) 8.17%

Structure diagram

Structure diagram
Structure diagram
vertex count | 13 edge count | 16 Schultz index | 728 Wiener index | 182 Hosoya index | 215 Balaban index | 2.634
vertex count | 13 edge count | 16 Schultz index | 728 Wiener index | 182 Hosoya index | 215 Balaban index | 2.634

Basic properties

molar mass | 392.18 g/mol
molar mass | 392.18 g/mol

Units

Chemical identifiers

CAS number | 12192-57-3 PubChem CID number | 6104 SMILES identifier | C(C1C(C(C(C(O1)[S-])O)O)O)O.[Au+] InChI identifier | InChI=1/C6H12O5S.Au/c7-1-2-3(8)4(9)5(10)6(12)11-2;/h2-10, 12H, 1H2;/q;+1/p-1/t2-, 3-, 4+, 5-, 6-;/m1./s1/fC6H11O5S.Au/h12h;/q-1;m EU number | 235-365-7 Gmelin number | 1268277 RTECS number | MD6475000
CAS number | 12192-57-3 PubChem CID number | 6104 SMILES identifier | C(C1C(C(C(C(O1)[S-])O)O)O)O.[Au+] InChI identifier | InChI=1/C6H12O5S.Au/c7-1-2-3(8)4(9)5(10)6(12)11-2;/h2-10, 12H, 1H2;/q;+1/p-1/t2-, 3-, 4+, 5-, 6-;/m1./s1/fC6H11O5S.Au/h12h;/q-1;m EU number | 235-365-7 Gmelin number | 1268277 RTECS number | MD6475000

Toxicity properties

RTECS classes | tumorigen | drug | reproductive effector | human data
RTECS classes | tumorigen | drug | reproductive effector | human data