Search

copper(II) nitrate

Input interpretation

copper(II) nitrate
copper(II) nitrate

Chemical names and formulas

formula | Cu(NO_3)_2 Hill formula | CuN_2O_6 name | copper(II) nitrate alternate names | copper dinitrate | cupric nitrate mass fractions | Cu (copper) 33.9% | N (nitrogen) 14.9% | O (oxygen) 51.2%
formula | Cu(NO_3)_2 Hill formula | CuN_2O_6 name | copper(II) nitrate alternate names | copper dinitrate | cupric nitrate mass fractions | Cu (copper) 33.9% | N (nitrogen) 14.9% | O (oxygen) 51.2%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 187.55 g/mol
molar mass | 187.55 g/mol

Units

Chemical identifiers

CAS number | 3251-23-8 PubChem CID number | 18616 SMILES identifier | [Cu+2].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-] MDL number | MFCD00010967
CAS number | 3251-23-8 PubChem CID number | 18616 SMILES identifier | [Cu+2].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-] MDL number | MFCD00010967

Ion equivalents

Cu^(2+) (copper(II) cation) | 1 (NO_3)^- (nitrate anion) | 2
Cu^(2+) (copper(II) cation) | 1 (NO_3)^- (nitrate anion) | 2

Random Queries

benzene absorbs light up to what wavelength?
density of strontium sulfate vs phosphorus trichloride
IUPAC name of sodium perchlorate vs potassium perchlorate
freezing point of trimethylphenylphosphonium iodide
molar mass of ethyl hexanoate vs vitamin A
CAS number of penfluridol vs (R)-(-)-N-benzyl-1-(1-naphthyl)ethylamine hydrochloride
atomic number of indium vs palladium
formula of oxygen(I) cation vs lead(II) cation
InChI identifier of 11-(2,2-dimethylpropyl)heneicosane
doxycycline hyclate