Search

InChI identifier of soda ash

Input interpretation

soda ash | InChI identifier
soda ash | InChI identifier

Result

InChI=1/CH2O3.2Na/c2-1(3)4;;/h(H2, 2, 3, 4);;/q;2*+1/p-2/fCO3.2Na/q-2;2m
InChI=1/CH2O3.2Na/c2-1(3)4;;/h(H2, 2, 3, 4);;/q;2*+1/p-2/fCO3.2Na/q-2;2m

Random Queries

IUPAC name of 2,5-dibromo-3-octylthiophene
crystal system of aeschynite-(Ce)
mass magnetic susceptibilities of group 9 elements
DOT numbers of potassium iodide vs ammonium bisulfate
CAS number of phosphine
name of perbromate anion vs hydrogen chromate anion
formula string of potassium pyrosulfate vs iridium(III) bromide hydrate
NFPA reactivity rating of calcium hydroxide vs magnesium hydroxide
alternate names of gray selenium vs vanadium(II) oxide
luster of allabogdanite vs sulfur