Search

name of tetrafluoroboric acid diethyl ether complex

Input interpretation

tetrafluoroboric acid diethyl ether complex
tetrafluoroboric acid diethyl ether complex

Chemical names and formulas

formula | HBF_4·O(CH_2CH_3)_2 Hill formula | C_4H_11BF_4O name | tetrafluoroboric acid diethyl ether complex IUPAC name | ethoxyethane; hydron; tetrafluoroborate alternate names | ethoxyethane; hydron; tetrafluoroborate | fluoroboric acid diethyl ether complex mass fractions | B (boron) 6.68% | C (carbon) 29.7% | F (fluorine) 46.9% | H (hydrogen) 6.85% | O (oxygen) 9.88%
formula | HBF_4·O(CH_2CH_3)_2 Hill formula | C_4H_11BF_4O name | tetrafluoroboric acid diethyl ether complex IUPAC name | ethoxyethane; hydron; tetrafluoroborate alternate names | ethoxyethane; hydron; tetrafluoroborate | fluoroboric acid diethyl ether complex mass fractions | B (boron) 6.68% | C (carbon) 29.7% | F (fluorine) 46.9% | H (hydrogen) 6.85% | O (oxygen) 9.88%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 161.93 g/mol density | 1.19 g/cm^3
molar mass | 161.93 g/mol density | 1.19 g/cm^3

Units

Chemical identifiers

CAS number | 67969-82-8 PubChem CID number | 16211330 PubChem SID number | 24864866 SMILES identifier | [H+].[B-](F)(F)(F)F.CCOCC InChI identifier | InChI=1/C4H10O.BF4/c1-3-5-4-2;2-1(3, 4)5/h3-4H2, 1-2H3;/q;-1/p+1/fC4H10O.BF4.H/q;m;+1 MDL number | MFCD00085352
CAS number | 67969-82-8 PubChem CID number | 16211330 PubChem SID number | 24864866 SMILES identifier | [H+].[B-](F)(F)(F)F.CCOCC InChI identifier | InChI=1/C4H10O.BF4/c1-3-5-4-2;2-1(3, 4)5/h3-4H2, 1-2H3;/q;-1/p+1/fC4H10O.BF4.H/q;m;+1 MDL number | MFCD00085352

Safety properties

flash point | -40 °C
flash point | -40 °C