Search

InChI identifier of sodium bicarbonate

Input interpretation

sodium bicarbonate | InChI identifier
sodium bicarbonate | InChI identifier

Result

InChI=1/CH2O3.Na/c2-1(3)4;/h(H2, 2, 3, 4);/q;+1/p-1/fCHO3.Na/h2H;/q-1;m
InChI=1/CH2O3.Na/c2-1(3)4;/h(H2, 2, 3, 4);/q;+1/p-1/fCHO3.Na/h2H;/q-1;m

Random Queries

phase of N,N-dimethylformamide
stearoyl chloride
Hill formula string of (1,1-dimethylbutyl)benzene
CAS potassium chromate
longest straight chain 2-(ethylthio)benzothiazole
boiling point of ethyl ether
name of aluminum dodecaboride vs vanadyl sulfate pentahydrate
CAS number of 4,4'-dibromobenzophenone
Cl2 + C4H10 = HCl + C4H9Cl
IUPAC name of 1,10-phenanthroline hydrochloride vs 6-chloropyridine-2-carboxylic acid