Search

InChI identifier of sodium bicarbonate

Input interpretation

sodium bicarbonate | InChI identifier
sodium bicarbonate | InChI identifier

Result

InChI=1/CH2O3.Na/c2-1(3)4;/h(H2, 2, 3, 4);/q;+1/p-1/fCHO3.Na/h2H;/q-1;m
InChI=1/CH2O3.Na/c2-1(3)4;/h(H2, 2, 3, 4);/q;+1/p-1/fCHO3.Na/h2H;/q-1;m

Random Queries

discovery year of zirsinalite
CAS number of cadmium cyanide vs lead(II) chromate
density of barium molybdate vs 5-(1,3-dioxolan-2-yl)-2-thienylzinc bromide
alternate names of phosphate anion vs hydride anion
crystal class of phyllotungstite vs jixianite
short electronic configuration of iron vs selenium
phase of white tin
unit cell angles of acetamide
CAS number of delta-valerolactone
H2SO4 + K = H2 + K2SO4