Search

terbium(III,IV) oxide

Input interpretation

terbium(III, IV) oxide
terbium(III, IV) oxide

Chemical names and formulas

formula | Tb_4O_7 Hill formula | O_7Tb_4 name | terbium(III, IV) oxide mass fractions | O (oxygen) 15% | Tb (terbium) 85%
formula | Tb_4O_7 Hill formula | O_7Tb_4 name | terbium(III, IV) oxide mass fractions | O (oxygen) 15% | Tb (terbium) 85%

Structure diagram

Structure diagram
Structure diagram
vertex count | 11 edge count | 10 Schultz index | 668 Wiener index | 184 Hosoya index | 112 Balaban index | 3.318
vertex count | 11 edge count | 10 Schultz index | 668 Wiener index | 184 Hosoya index | 112 Balaban index | 3.318

Basic properties

molar mass | 747.69 g/mol density | 7.3 g/cm^3
molar mass | 747.69 g/mol density | 7.3 g/cm^3

Units

Chemical identifiers

CAS number | 12037-01-3 PubChem CID number | 16211492 PubChem SID number | 24852278 SMILES identifier | O=[Tb]O[Tb](=O)O[Tb](=O)O[Tb]=O InChI identifier | InChI=1/7O.4Tb/rO7Tb4/c1-8-5-10(3)7-11(4)6-9-2 MDL number | MFCD00083151
CAS number | 12037-01-3 PubChem CID number | 16211492 PubChem SID number | 24852278 SMILES identifier | O=[Tb]O[Tb](=O)O[Tb](=O)O[Tb]=O InChI identifier | InChI=1/7O.4Tb/rO7Tb4/c1-8-5-10(3)7-11(4)6-9-2 MDL number | MFCD00083151

Toxicity properties

odor | odorless
odor | odorless

Random Queries

embossing image kozulite
IUPAC name of potassium acetate vs phenyl carbonate
DOT numbers of calcium
density of tribromosilane
space group of insulators
lithium-7 li hydroxide monohydrate
morphological erosion image albite
name of hydronium cation vs tetraethylammonium cation
SMILES identifier of L-lysine vs copper
densities of ionic diatomics