Search

SMILES identifier of zinc niobate

Input interpretation

zinc niobate | SMILES identifier
zinc niobate | SMILES identifier

Result

[O-][Nb](=O)=O.[O-][Nb](=O)=O.[Zn+2]
[O-][Nb](=O)=O.[O-][Nb](=O)=O.[Zn+2]

Random Queries

decay modes of Np-235
molar mass of copper(II) tetrafluoroborate hydrate vs 2-fluoro-6-iodophenylboronic acid
Al2O3 + HF = H2O + AlF3
ion class of lead(IV) cation vs thallium(III) cation
Br2 + Cl
atomic number of phosphorus vs xenon
flash point of pine oil
find morphological perimeter image actinolite
element types of α-berkelium
alternate names of perchlorate anion vs hydroxide anion