Search

SMILES identifier of zinc niobate

Input interpretation

zinc niobate | SMILES identifier
zinc niobate | SMILES identifier

Result

[O-][Nb](=O)=O.[O-][Nb](=O)=O.[Zn+2]
[O-][Nb](=O)=O.[O-][Nb](=O)=O.[Zn+2]

Random Queries

chemical types of uranyl nitrate vs cobalt phosphide
ethyl 3-(3, 4-dimethoxyphenyl)propionate
molar mass of gold(III) iodide
molar mass of hydrogen hexabromoplatinate(IV) hydrate vs dysprosium(III) sulfate octahydrate
IUPAC name of calcium chlorite
3 moles of air
gold(III) ions
boiling point of hydrogen vs nitrogen
formula of palladium(II) sulfate vs lead arsenite
formula of calcium cation vs strontium cation