Search

InChI identifier of copper(II) oxalate

Input interpretation

copper(II) oxalate | InChI identifier
copper(II) oxalate | InChI identifier

Result

InChI=1/C2H2O4.Cu/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Cu/q-2;m
InChI=1/C2H2O4.Cu/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Cu/q-2;m

Random Queries

Fm-252
melting point of gold vs lead
Hill formula string of trichlorofluoromethane
group of carbon vs fluorine
phase at STP of hafnium vs promethium
PubChem SID number of hafnium(IV) carbide
ion class of tungsten(VI) cation vs manganese(IV) cation
boiling point of period 5 elements
group of antimony
hydrogen, iron, I