Search

InChI identifier of copper(II) oxalate

Input interpretation

copper(II) oxalate | InChI identifier
copper(II) oxalate | InChI identifier

Result

InChI=1/C2H2O4.Cu/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Cu/q-2;m
InChI=1/C2H2O4.Cu/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Cu/q-2;m

Random Queries

freezing point of 3,5-diiodosalicylic acid
formula of ammonium nitrite vs sodium aluminum hydride
ruthenium(IV) oxide hydrate
melting point of silver nitrate
formula of rhenium(VI) fluoride vs holmium sulfide
longest chain length of gadoversetamide vs dilithium phthalocyanine
atomic number of actinium
alternate names of 3,4-dimethylhexane vs 1,8-nonadiene
crystal system of aguilarite
molar mass of rhodium IV