Search

InChI identifier of methane vs isododecane

Input interpretation

methane isododecane | InChI identifier
methane isododecane | InChI identifier

Results

methane | InChI=1/CH4/h1H4 isododecane | InChI=1/C12H26/c1-4-5-6-7-8-9-10-11-12(2)3/h12H, 4-11H2, 1-3H3
methane | InChI=1/CH4/h1H4 isododecane | InChI=1/C12H26/c1-4-5-6-7-8-9-10-11-12(2)3/h12H, 4-11H2, 1-3H3

Random Queries

chromium(VI) cation vs cobalt(II) cation vs iron(III) cation
alternate names of iodide anion vs chromium(III) cation
phenethyl alcohol vs benzyl alcohol-α,α-d 2
kadyrelite
Cl2 + B = BCl3
common source of ion of chromate anion vs thiosulfate anion
formula of potassium phthalimide
DOT numbers of metaphosphoric acid
HCl + KNO2 + PbO2 = H2O + KNO3 + PbCl2
valences of alkaline earth metals