Search

InChI identifier of L-lysine

Input interpretation

L-lysine | InChI identifier
L-lysine | InChI identifier

Result

InChI=1/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H, 1-4, 7-8H2, (H, 9, 10)/t5-/m0/s1/f/h9H
InChI=1/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H, 1-4, 7-8H2, (H, 9, 10)/t5-/m0/s1/f/h9H

Random Queries

name of bismuth germanium oxide
formula of serum albumin vs 2-pyridinecarboxaldehyde
element types of 1,1-dimethylcyclopropane
molar heat capacities of group 8 elements
carbon vs fluorine vs oxygen vs nitrogen
3 moles of nonane
triiodide anion vs bromide anion vs tin(II) cation
H2O + Cl2 + Na2S2O3 = HCl + Na2SO4SO4
CAS number of sulfur allotropes
Cl2 + H2O2 = O2 + HCl