Search

chromium trioxide solid

Input interpretation

chromium trioxide | phase | solid
chromium trioxide | phase | solid

Thermodynamic properties of matter

phase | solid temperature | 298.2 K pressure | 1 atm
phase | solid temperature | 298.2 K pressure | 1 atm

Structure diagram

Structure diagram
Structure diagram
vertex count | 4 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
vertex count | 4 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324

Basic properties

formula | CrO_3 name | chromium trioxide IUPAC name | trioxochromium molar mass | 99.993 g/mol
formula | CrO_3 name | chromium trioxide IUPAC name | trioxochromium molar mass | 99.993 g/mol

Units

Chemical identifiers

CAS number | 1333-82-0 PubChem CID number | 14915 SMILES identifier | O=[Cr](=O)=O InChI identifier | InChI=1/Cr.3O/rCrO3/c2-1(3)4 RTECS number | GB6650000 MDL number | MFCD00010952
CAS number | 1333-82-0 PubChem CID number | 14915 SMILES identifier | O=[Cr](=O)=O InChI identifier | InChI=1/Cr.3O/rCrO3/c2-1(3)4 RTECS number | GB6650000 MDL number | MFCD00010952

Random Queries

O2 + C2 = CO2
CH4 = H2 + C
brand calcium chloride
HNO3 + ZnCl2 = HCl + Zn(NO3)2
name of strontium hydride vs nickel(II,III) sulfide
formula of propylene glycol vs cra_7806
ion class of carbonate anion vs chlorate anion
alternate names of o-toluidine hydrochloride
erythromycin stearate vs 1-benzyl-3-pyrrolidinol
CAS number of calcium telluride vs chromic chloride