Search

chromium trioxide solid

Input interpretation

chromium trioxide | phase | solid
chromium trioxide | phase | solid

Thermodynamic properties of matter

phase | solid temperature | 298.2 K pressure | 1 atm
phase | solid temperature | 298.2 K pressure | 1 atm

Structure diagram

Structure diagram
Structure diagram
vertex count | 4 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
vertex count | 4 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324

Basic properties

formula | CrO_3 name | chromium trioxide IUPAC name | trioxochromium molar mass | 99.993 g/mol
formula | CrO_3 name | chromium trioxide IUPAC name | trioxochromium molar mass | 99.993 g/mol

Units

Chemical identifiers

CAS number | 1333-82-0 PubChem CID number | 14915 SMILES identifier | O=[Cr](=O)=O InChI identifier | InChI=1/Cr.3O/rCrO3/c2-1(3)4 RTECS number | GB6650000 MDL number | MFCD00010952
CAS number | 1333-82-0 PubChem CID number | 14915 SMILES identifier | O=[Cr](=O)=O InChI identifier | InChI=1/Cr.3O/rCrO3/c2-1(3)4 RTECS number | GB6650000 MDL number | MFCD00010952

Random Queries

melting point of terbium
(boiling point of fluorine)/(critical temperature of fluorine)
alternate names of ammonium cation vs tetraethylammonium cation
atomic number of fluorine vs iodine
net ionic charge of ammonium cation vs hydrogen carbonate anion
formula of 4-fluoro-1-naphthoic acid vs D-dibenzoyltartaric acid
image closing image bustamite
lithium-6Li hydroxide monohydrate vs strontium selenate
mercury(I) sulfate
oil painting effect image of ferberite