Search

InChI identifier of acetaminophen

Input interpretation

acetaminophen | InChI identifier
acetaminophen | InChI identifier

Result

InChI=1/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5, 11H, 1H3, (H, 9, 10)/f/h9H
InChI=1/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5, 11H, 1H3, (H, 9, 10)/f/h9H

Random Queries

alternate names of lithium p-toluenesulfinate
isotope abundances of group 1 elements
alternate names of ammonium chromate vs gallium(III) iodide
molar mass of dansyllysine vs b-nonylglucoside
image of kozulite
freezing point of cis-difluorodiazine vs cerium fluoride
covalent radius of group 5 elements
molar mass of 9-phenanthrylmagnesium bromide vs ethyl eosin
iron(I) cation vs cobalt(III) cation vs yttrium(III) cation vs rhenium(III) cation
hydroxide anion vs chlorate anion vs chromate anion